C45H71O8PSi2 — CID 11262939
(3S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-10-[tert-butyl(diphenyl)silyl]oxy-1-diethoxyphosphoryl-6-[(4-methoxyphenyl)methoxy]-3-methyldecan-2-one (PubChem CID 11262939) has the molecular formula C45H71O8PSi2 and a molecular weight of 827.20 g/mol. Its IUPAC name is (3S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-10-[tert-butyl(diphenyl)silyl]oxy-1-diethoxyphosphoryl-6-[(4-methoxyphenyl)methoxy]-3-methyldecan-2-one.
| Compound Name | (3S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-10-[tert-butyl(diphenyl)silyl]oxy-1-diethoxyphosphoryl-6-[(4-methoxyphenyl)methoxy]-3-methyldecan-2-one |
|---|---|
| PubChem CID | 11262939 |
| Molecular Formula | C45H71O8PSi2 |
| Molecular Weight | 827.20 g/mol |
| Exact Mass | 826.44 |
| IUPAC Name | (3S,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-10-[tert-butyl(diphenyl)silyl]oxy-1-diethoxyphosphoryl-6-[(4-methoxyphenyl)methoxy]-3-methyldecan-2-one |
| SMILES | CCOP(=O)(CC(=O)[C@@H](C)[C@H](C[C@@H](CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCc1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C)OCC |
| InChI | InChI=1S/C45H71O8PSi2/c1-13-50-54(47,51-14-2)35-42(46)36(3)43(53-55(11,12)44(4,5)6)33-39(49-34-37-28-30-38(48-10)31-29-37)23-21-22-32-52-56(45(7,8)9,40-24-17-15-18-25-40)41-26-19-16-20-27-41/h15-20,24-31,36,39,43H,13-14,21-23,32-35H2,1-12H3/t36-,39-,43+/m1/s1 |
| InChIKey | ZOVOXVPDTIUHOF-OJTCIBNZSA-N |
| XLogP | 10.58 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.20 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|