C46H74O6SSi3 — CID 42631664
S-ethyl (2S,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]-4-methyl-6-triethylsilyloxyheptanethioate (PubChem CID 42631664) has the molecular formula C46H74O6SSi3 and a molecular weight of 839.42 g/mol. Its IUPAC name is S-ethyl (2S,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]-4-methyl-6-triethylsilyloxyheptanethioate.
| Compound Name | S-ethyl (2S,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]-4-methyl-6-triethylsilyloxyheptanethioate |
|---|---|
| PubChem CID | 42631664 |
| Molecular Formula | C46H74O6SSi3 |
| Molecular Weight | 839.42 g/mol |
| Exact Mass | 838.45 |
| IUPAC Name | S-ethyl (2S,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]-4-methyl-6-triethylsilyloxyheptanethioate |
| SMILES | CCSC(=O)[C@@H](OCc1ccc(OC)cc1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C46H74O6SSi3/c1-15-53-44(47)43(49-34-37-29-31-38(48-12)32-30-37)42(52-54(13,14)45(6,7)8)36(5)33-39(51-55(16-2,17-3)18-4)35-50-56(46(9,10)11,40-25-21-19-22-26-40)41-27-23-20-24-28-41/h19-32,36,39,42-43H,15-18,33-35H2,1-14H3/t36-,39-,42-,43+/m1/s1 |
| InChIKey | HCWYWUJRWKSDTC-UUAMKGFUSA-N |
| XLogP | 11.24 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.42 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|