C10H6OS3 — CID 11264914
2,3lambda4,4-trithiatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene 3-oxide (PubChem CID 11264914) has the molecular formula C10H6OS3 and a molecular weight of 238.36 g/mol. Its IUPAC name is 2,3lambda4,4-trithiatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene 3-oxide.
| Compound Name | 2,3lambda4,4-trithiatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene 3-oxide |
|---|---|
| PubChem CID | 11264914 |
| Molecular Formula | C10H6OS3 |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | 2,3lambda4,4-trithiatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene 3-oxide |
| SMILES | O=S1Sc2cccc3cccc(c23)S1 |
| InChI | InChI=1S/C10H6OS3/c11-14-12-8-5-1-3-7-4-2-6-9(13-14)10(7)8/h1-6H |
| InChIKey | QWLZDIZZXHMCCT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|