C13H17IO6 — CID 11280913
[(3aR,4S,5R,7aR)-5-acetyloxy-6-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate (PubChem CID 11280913) has the molecular formula C13H17IO6 and a molecular weight of 396.18 g/mol. Its IUPAC name is [(3aR,4S,5R,7aR)-5-acetyloxy-6-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate.
| Compound Name | [(3aR,4S,5R,7aR)-5-acetyloxy-6-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate |
|---|---|
| PubChem CID | 11280913 |
| Molecular Formula | C13H17IO6 |
| Molecular Weight | 396.18 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | [(3aR,4S,5R,7aR)-5-acetyloxy-6-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2OC(C)(C)O[C@@H]2C=C(I)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H17IO6/c1-6(15)17-10-8(14)5-9-11(12(10)18-7(2)16)20-13(3,4)19-9/h5,9-12H,1-4H3/t9-,10+,11-,12-/m1/s1 |
| InChIKey | FJESJQMUKPXRBZ-WRWGMCAJSA-N |
| XLogP | 1.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.18 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|