C28H46O5Si2 — CID 11329822
4-[tert-butyl(dimethyl)silyl]oxy-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-5,8-dimethoxynaphthalen-1-ol (PubChem CID 11329822) has the molecular formula C28H46O5Si2 and a molecular weight of 518.84 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-5,8-dimethoxynaphthalen-1-ol.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-5,8-dimethoxynaphthalen-1-ol |
|---|---|
| PubChem CID | 11329822 |
| Molecular Formula | C28H46O5Si2 |
| Molecular Weight | 518.84 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-5,8-dimethoxynaphthalen-1-ol |
| SMILES | C=CC[C@@H](O[Si](C)(C)C(C)(C)C)c1cc(O[Si](C)(C)C(C)(C)C)c2c(OC)ccc(OC)c2c1O |
| InChI | InChI=1S/C28H46O5Si2/c1-14-15-20(32-34(10,11)27(2,3)4)19-18-23(33-35(12,13)28(5,6)7)24-21(30-8)16-17-22(31-9)25(24)26(19)29/h14,16-18,20,29H,1,15H2,2-13H3/t20-/m1/s1 |
| InChIKey | NQZTUAFERMNYBK-HXUWFJFHSA-N |
| XLogP | 8.59 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.84 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|