C19H30N2O4Si — CID 11188119
5-[2-amino-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-hydroxy-7-methoxy-1-methylquinolin-4-one (PubChem CID 11188119) has the molecular formula C19H30N2O4Si and a molecular weight of 378.55 g/mol. Its IUPAC name is 5-[2-amino-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-hydroxy-7-methoxy-1-methylquinolin-4-one.
| Compound Name | 5-[2-amino-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-hydroxy-7-methoxy-1-methylquinolin-4-one |
|---|---|
| PubChem CID | 11188119 |
| Molecular Formula | C19H30N2O4Si |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 5-[2-amino-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-hydroxy-7-methoxy-1-methylquinolin-4-one |
| SMILES | COc1cc(C(CN)O[Si](C)(C)C(C)(C)C)c2c(=O)ccn(C)c2c1O |
| InChI | InChI=1S/C19H30N2O4Si/c1-19(2,3)26(6,7)25-15(11-20)12-10-14(24-5)18(23)17-16(12)13(22)8-9-21(17)4/h8-10,15,23H,11,20H2,1-7H3 |
| InChIKey | BXEFFDJSVCNKPJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|