C18H26N2O4Si — CID 89266920
[5-[(1R)-2-amino-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1H-quinolin-8-yl] formate (PubChem CID 89266920) has the molecular formula C18H26N2O4Si and a molecular weight of 362.50 g/mol. Its IUPAC name is [5-[(1R)-2-amino-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1H-quinolin-8-yl] formate.
| Compound Name | [5-[(1R)-2-amino-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1H-quinolin-8-yl] formate |
|---|---|
| PubChem CID | 89266920 |
| Molecular Formula | C18H26N2O4Si |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [5-[(1R)-2-amino-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1H-quinolin-8-yl] formate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CN)c1ccc(OC=O)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C18H26N2O4Si/c1-18(2,3)25(4,5)24-15(10-19)12-6-8-14(23-11-21)17-13(12)7-9-16(22)20-17/h6-9,11,15H,10,19H2,1-5H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | YYSATMSYRHBVHP-HNNXBMFYSA-N |
| XLogP | 3.08 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|