C36H40NOP — CID 11330058
1-[(2S)-4,4-dibenzyl-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 11330058) has the molecular formula C36H40NOP and a molecular weight of 533.70 g/mol. Its IUPAC name is 1-[(2S)-4,4-dibenzyl-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(2S)-4,4-dibenzyl-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 11330058 |
| Molecular Formula | C36H40NOP |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 1-[(2S)-4,4-dibenzyl-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CC(Cc2ccccc2)(Cc2ccccc2)C[C@H]1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H40NOP/c1-35(2,3)34(38)37-28-36(24-29-16-8-4-9-17-29,25-30-18-10-5-11-19-30)26-31(37)27-39(32-20-12-6-13-21-32)33-22-14-7-15-23-33/h4-23,31H,24-28H2,1-3H3/t31-/m0/s1 |
| InChIKey | NOQQOIKBFDMSEY-HKBQPEDESA-N |
| XLogP | 7.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|