C20H20BBrP — CID 57379173
CID 57379173 (PubChem CID 57379173) has the molecular formula C20H20BBrP and a molecular weight of 382.07 g/mol.
| Compound Name | CID 57379173 |
|---|---|
| PubChem CID | 57379173 |
| Molecular Formula | C20H20BBrP |
| Molecular Weight | 382.07 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | — |
| SMILES | Br[C@@H]1C[C@@]12C[C@]21C[C@H]1CP(c1ccccc1)c1ccccc1.[B] |
| InChI | InChI=1S/C20H20BrP.B/c21-18-12-20(18)14-19(20)11-15(19)13-22(16-7-3-1-4-8-16)17-9-5-2-6-10-17;/h1-10,15,18H,11-14H2;/t15-,18+,19-,20+;/m0./s1 |
| InChIKey | QGTZBUHXSWHCTC-WOINEZMTSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.07 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|