C32H30B2P2 — CID 57379175
CID 57379175 (PubChem CID 57379175) has the molecular formula C32H30B2P2 and a molecular weight of 498.16 g/mol.
| Compound Name | CID 57379175 |
|---|---|
| PubChem CID | 57379175 |
| Molecular Formula | C32H30B2P2 |
| Molecular Weight | 498.16 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | — |
| SMILES | [B].[B].c1ccc(P(C[C@@H]2C[C@]23C[C@@]32C[C@H]2P(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H30P2.2B/c1-5-13-26(14-6-1)33(27-15-7-2-8-16-27)23-25-21-31(25)24-32(31)22-30(32)34(28-17-9-3-10-18-28)29-19-11-4-12-20-29;;/h1-20,25,30H,21-24H2;;/t25-,30+,31-,32+;;/m0../s1 |
| InChIKey | QRGMMXDERDSHDY-AIUBPGBASA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.16 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|