C37H55NO8Si — CID 11342842
methyl (2S)-4-[[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (PubChem CID 11342842) has the molecular formula C37H55NO8Si and a molecular weight of 669.93 g/mol. Its IUPAC name is methyl (2S)-4-[[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate.
| Compound Name | methyl (2S)-4-[[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 11342842 |
| Molecular Formula | C37H55NO8Si |
| Molecular Weight | 669.93 g/mol |
| Exact Mass | 669.37 |
| IUPAC Name | methyl (2S)-4-[[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| SMILES | C=C(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC)C[C@H]1OCC(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H55NO8Si/c1-26(21-29(34(39)41-8)38-35(40)45-36(2,3)4)22-30-33(46-47(9,10)37(5,6)7)32(44-24-28-19-15-12-16-20-28)31(25-43-30)42-23-27-17-13-11-14-18-27/h11-20,29-33H,1,21-25H2,2-10H3,(H,38,40)/t29-,30+,31?,32+,33+/m0/s1 |
| InChIKey | PMVPRZVQJIEQBM-WKVDYERZSA-N |
| XLogP | 7.35 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.93 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|