C9H6Cl4O2 — CID 11346738
2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenol (PubChem CID 11346738) has the molecular formula C9H6Cl4O2 and a molecular weight of 287.96 g/mol. Its IUPAC name is 2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenol.
| Compound Name | 2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenol |
|---|---|
| PubChem CID | 11346738 |
| Molecular Formula | C9H6Cl4O2 |
| Molecular Weight | 287.96 g/mol |
| Exact Mass | 285.91 |
| IUPAC Name | 2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenol |
| SMILES | Oc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C9H6Cl4O2/c10-6-3-5(4-7(11)9(6)14)15-2-1-8(12)13/h1,3-4,14H,2H2 |
| InChIKey | URMCRIARAXDJTP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.96 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |