C17H22O10 — CID 11406528
[(2R,3R,4S,5S)-3,4-diacetyloxy-5-[(1S,4R)-1,4-dimethyl-2,3,7-trioxabicyclo[2.2.1]hept-5-en-5-yl]oxolan-2-yl]methyl acetate (PubChem CID 11406528) has the molecular formula C17H22O10 and a molecular weight of 386.35 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3,4-diacetyloxy-5-[(1S,4R)-1,4-dimethyl-2,3,7-trioxabicyclo[2.2.1]hept-5-en-5-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S)-3,4-diacetyloxy-5-[(1S,4R)-1,4-dimethyl-2,3,7-trioxabicyclo[2.2.1]hept-5-en-5-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11406528 |
| Molecular Formula | C17H22O10 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | [(2R,3R,4S,5S)-3,4-diacetyloxy-5-[(1S,4R)-1,4-dimethyl-2,3,7-trioxabicyclo[2.2.1]hept-5-en-5-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](C2=C[C@]3(C)OO[C@@]2(C)O3)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H22O10/c1-8(18)21-7-12-14(22-9(2)19)15(23-10(3)20)13(24-12)11-6-16(4)25-17(11,5)27-26-16/h6,12-15H,7H2,1-5H3/t12-,13+,14-,15+,16+,17-/m1/s1 |
| InChIKey | JQGPLCDJZFBKCI-IAFLNBNSSA-N |
| XLogP | 0.53 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|