3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride

C8H4Br2ClN3O2S — CID 114376515

IUPAC3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride
SMILESO=S(=O)(Cl)c1nc(-c2cc(Br)ccc2Br)n[nH]1
InChIInChI=1S/C8H4Br2ClN3O2S/c9-4-1-2-6(10)5(3-4)7-12-8(14-13-7)17(11,15)16/h1-3H,(H,12,13,14)
InChIKeyHGJUZRPORVZNLJ-UHFFFAOYSA-N
MW401.47 g/mol
LogP2.92
Rot. Bonds2

About 3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride

3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride (PubChem CID 114376515) has the molecular formula C8H4Br2ClN3O2S and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride.

Molecular Properties

Compound Name3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride
PubChem CID114376515
Molecular FormulaC8H4Br2ClN3O2S
Molecular Weight401.47 g/mol
Exact Mass398.81
IUPAC Name3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride
SMILESO=S(=O)(Cl)c1nc(-c2cc(Br)ccc2Br)n[nH]1
InChIInChI=1S/C8H4Br2ClN3O2S/c9-4-1-2-6(10)5(3-4)7-12-8(14-13-7)17(11,15)16/h1-3H,(H,12,13,14)
InChIKeyHGJUZRPORVZNLJ-UHFFFAOYSA-N
XLogP2.92
TPSA75.71 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500401.47
LogP ≤ 52.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride?
The IUPAC name of 3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride (CID 114376515) is 3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride.
What is the SMILES notation for 3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride?
The canonical SMILES for 3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride is O=S(=O)(Cl)c1nc(-c2cc(Br)ccc2Br)n[nH]1.
What is the InChIKey of 3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride?
The InChIKey is HGJUZRPORVZNLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Br2ClN3O2S/c9-4-1-2-6(10)5(3-4)7-12-8(14-13-7)17(11,15)16/h1-3H,(H,12,13,14).
What are the key properties of 3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride?
3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride has a molecular weight of 401.47 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride is sourced from PubChem (CID 114376515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).