C8H4Br2ClN3O2S — CID 114376515
3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride (PubChem CID 114376515) has the molecular formula C8H4Br2ClN3O2S and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride.
| Compound Name | 3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride |
|---|---|
| PubChem CID | 114376515 |
| Molecular Formula | C8H4Br2ClN3O2S |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 398.81 |
| IUPAC Name | 3-(2,5-dibromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1nc(-c2cc(Br)ccc2Br)n[nH]1 |
| InChI | InChI=1S/C8H4Br2ClN3O2S/c9-4-1-2-6(10)5(3-4)7-12-8(14-13-7)17(11,15)16/h1-3H,(H,12,13,14) |
| InChIKey | HGJUZRPORVZNLJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |