C8H16F2OSi — CID 11480993
1-[tert-butyl(dimethyl)silyl]-2,2-difluoroethanone (PubChem CID 11480993) has the molecular formula C8H16F2OSi and a molecular weight of 194.30 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]-2,2-difluoroethanone.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]-2,2-difluoroethanone |
|---|---|
| PubChem CID | 11480993 |
| Molecular Formula | C8H16F2OSi |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]-2,2-difluoroethanone |
| SMILES | CC(C)(C)[Si](C)(C)C(=O)C(F)F |
| InChI | InChI=1S/C8H16F2OSi/c1-8(2,3)12(4,5)7(11)6(9)10/h6H,1-5H3 |
| InChIKey | GXEOOIKAXXLFGM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|