C10H13F3N4O2S — CID 114813203
2-phenyl-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide (PubChem CID 114813203) has the molecular formula C10H13F3N4O2S and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-phenyl-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide.
| Compound Name | 2-phenyl-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide |
|---|---|
| PubChem CID | 114813203 |
| Molecular Formula | C10H13F3N4O2S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-phenyl-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide |
| SMILES | [H]/N=C(\N)C(NS(=O)(=O)NCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H13F3N4O2S/c11-10(12,13)6-16-20(18,19)17-8(9(14)15)7-4-2-1-3-5-7/h1-5,8,16-17H,6H2,(H3,14,15) |
| InChIKey | VMMOZYONPHRKFX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|