C29H24Cl2N6O7 — CID 11498291
1-[3-chloro-2-(2-nitrophenyl)-4-oxoazetidin-1-yl]-3-[4-(4-chlorophenyl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]urea (PubChem CID 11498291) has the molecular formula C29H24Cl2N6O7 and a molecular weight of 639.45 g/mol. Its IUPAC name is 1-[3-chloro-2-(2-nitrophenyl)-4-oxoazetidin-1-yl]-3-[4-(4-chlorophenyl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]urea.
| Compound Name | 1-[3-chloro-2-(2-nitrophenyl)-4-oxoazetidin-1-yl]-3-[4-(4-chlorophenyl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 11498291 |
| Molecular Formula | C29H24Cl2N6O7 |
| Molecular Weight | 639.45 g/mol |
| Exact Mass | 638.11 |
| IUPAC Name | 1-[3-chloro-2-(2-nitrophenyl)-4-oxoazetidin-1-yl]-3-[4-(4-chlorophenyl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]urea |
| SMILES | COc1cc(-c2cc(-c3ccc(Cl)cc3)nc(NC(=O)NN3C(=O)C(Cl)C3c3ccccc3[N+](=O)[O-])n2)cc(OC)c1OC |
| InChI | InChI=1S/C29H24Cl2N6O7/c1-42-22-12-16(13-23(43-2)26(22)44-3)20-14-19(15-8-10-17(30)11-9-15)32-28(33-20)34-29(39)35-36-25(24(31)27(36)38)18-6-4-5-7-21(18)37(40)41/h4-14,24-25H,1-3H3,(H2,32,33,34,35,39) |
| InChIKey | FEFDVNKJNOJQGH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 158.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|