C10H15NO3 — CID 115065793
2-ethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-5-carboxylic acid (PubChem CID 115065793) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-ethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-5-carboxylic acid.
| Compound Name | 2-ethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 115065793 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-ethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-5-carboxylic acid |
| SMILES | CCC1=NC2CC(C(=O)O)CCC2O1 |
| InChI | InChI=1S/C10H15NO3/c1-2-9-11-7-5-6(10(12)13)3-4-8(7)14-9/h6-8H,2-5H2,1H3,(H,12,13) |
| InChIKey | HHUGBNUMTRYRLB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |