C21H29N3O4 — CID 11509307
3-[5-[4-[heptylcarbamoyl(methyl)amino]-2-pyridinyl]furan-2-yl]propanoic acid (PubChem CID 11509307) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 3-[5-[4-[heptylcarbamoyl(methyl)amino]-2-pyridinyl]furan-2-yl]propanoic acid.
| Compound Name | 3-[5-[4-[heptylcarbamoyl(methyl)amino]-2-pyridinyl]furan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 11509307 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 3-[5-[4-[heptylcarbamoyl(methyl)amino]-2-pyridinyl]furan-2-yl]propanoic acid |
| SMILES | CCCCCCCNC(=O)N(C)c1ccnc(-c2ccc(CCC(=O)O)o2)c1 |
| InChI | InChI=1S/C21H29N3O4/c1-3-4-5-6-7-13-23-21(27)24(2)16-12-14-22-18(15-16)19-10-8-17(28-19)9-11-20(25)26/h8,10,12,14-15H,3-7,9,11,13H2,1-2H3,(H,23,27)(H,25,26) |
| InChIKey | LWIDMWAWMKBRHM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|