C25H35N3O5 — CID 66591404
3-[4-[4-[heptylcarbamoyl(methyl)amino]pyridin-1-ium-2-yl]phenyl]propanoic acid acetate (PubChem CID 66591404) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is 3-[4-[4-[heptylcarbamoyl(methyl)amino]pyridin-1-ium-2-yl]phenyl]propanoic acid acetate.
| Compound Name | 3-[4-[4-[heptylcarbamoyl(methyl)amino]pyridin-1-ium-2-yl]phenyl]propanoic acid acetate |
|---|---|
| PubChem CID | 66591404 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 3-[4-[4-[heptylcarbamoyl(methyl)amino]pyridin-1-ium-2-yl]phenyl]propanoic acid acetate |
| SMILES | CC(=O)[O-].CCCCCCCNC(=O)N(C)c1cc[nH+]c(-c2ccc(CCC(=O)O)cc2)c1 |
| InChI | InChI=1S/C23H31N3O3.C2H4O2/c1-3-4-5-6-7-15-25-23(29)26(2)20-14-16-24-21(17-20)19-11-8-18(9-12-19)10-13-22(27)28;1-2(3)4/h8-9,11-12,14,16-17H,3-7,10,13,15H2,1-2H3,(H,25,29)(H,27,28);1H3,(H,3,4) |
| InChIKey | FRNBNBSNYVSZDM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|