C25H33N3O4 — CID 91240901
acetyl 3-[4-[4-[heptylcarbamoyl(methyl)amino]-2-pyridinyl]phenyl]propanoate (PubChem CID 91240901) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is acetyl 3-[4-[4-[heptylcarbamoyl(methyl)amino]-2-pyridinyl]phenyl]propanoate.
| Compound Name | acetyl 3-[4-[4-[heptylcarbamoyl(methyl)amino]-2-pyridinyl]phenyl]propanoate |
|---|---|
| PubChem CID | 91240901 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | acetyl 3-[4-[4-[heptylcarbamoyl(methyl)amino]-2-pyridinyl]phenyl]propanoate |
| SMILES | CCCCCCCNC(=O)N(C)c1ccnc(-c2ccc(CCC(=O)OC(C)=O)cc2)c1 |
| InChI | InChI=1S/C25H33N3O4/c1-4-5-6-7-8-16-27-25(31)28(3)22-15-17-26-23(18-22)21-12-9-20(10-13-21)11-14-24(30)32-19(2)29/h9-10,12-13,15,17-18H,4-8,11,14,16H2,1-3H3,(H,27,31) |
| InChIKey | ZBBHVIWVGYZFJI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|