C33H45NO12S — CID 11556604
diethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[(2R,3R,4R,5S)-3-methylsulfonyloxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl]propanedioate (PubChem CID 11556604) has the molecular formula C33H45NO12S and a molecular weight of 679.79 g/mol. Its IUPAC name is diethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[(2R,3R,4R,5S)-3-methylsulfonyloxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl]propanedioate.
| Compound Name | diethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[(2R,3R,4R,5S)-3-methylsulfonyloxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 11556604 |
| Molecular Formula | C33H45NO12S |
| Molecular Weight | 679.79 g/mol |
| Exact Mass | 679.27 |
| IUPAC Name | diethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[(2R,3R,4R,5S)-3-methylsulfonyloxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl]propanedioate |
| SMILES | CCOC(=O)C(C[C@H]1OCC(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OS(C)(=O)=O)(NC(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C33H45NO12S/c1-7-40-29(35)33(30(36)41-8-2,34-31(37)45-32(3,4)5)19-25-28(46-47(6,38)39)27(44-21-24-17-13-10-14-18-24)26(22-43-25)42-20-23-15-11-9-12-16-23/h9-18,25-28H,7-8,19-22H2,1-6H3,(H,34,37)/t25-,26?,27-,28-/m1/s1 |
| InChIKey | YIJSNNICBYOZLQ-RNXRYKQUSA-N |
| XLogP | 3.68 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.79 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|