C17H19Cl2N3O2S — CID 11567521
1-[4-[bis(2-chloroethyl)amino]phenyl]-3-(3,4-dihydroxyphenyl)thiourea (PubChem CID 11567521) has the molecular formula C17H19Cl2N3O2S and a molecular weight of 400.33 g/mol. Its IUPAC name is 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-(3,4-dihydroxyphenyl)thiourea.
| Compound Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-(3,4-dihydroxyphenyl)thiourea |
|---|---|
| PubChem CID | 11567521 |
| Molecular Formula | C17H19Cl2N3O2S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-(3,4-dihydroxyphenyl)thiourea |
| SMILES | Oc1ccc(NC(=S)Nc2ccc(N(CCCl)CCCl)cc2)cc1O |
| InChI | InChI=1S/C17H19Cl2N3O2S/c18-7-9-22(10-8-19)14-4-1-12(2-5-14)20-17(25)21-13-3-6-15(23)16(24)11-13/h1-6,11,23-24H,7-10H2,(H2,20,21,25) |
| InChIKey | SEJVFGWABWYBSK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|