C33H45N3O — CID 11569589
2-indol-1-yl-N-methyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]acetamide (PubChem CID 11569589) has the molecular formula C33H45N3O and a molecular weight of 499.74 g/mol. Its IUPAC name is 2-indol-1-yl-N-methyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]acetamide.
| Compound Name | 2-indol-1-yl-N-methyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]acetamide |
|---|---|
| PubChem CID | 11569589 |
| Molecular Formula | C33H45N3O |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.36 |
| IUPAC Name | 2-indol-1-yl-N-methyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]acetamide |
| SMILES | C[C@H]1[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](N(C)C(=O)Cn6ccc7ccccc76)CC[C@]5(C)C4CC[C@]23CN1C |
| InChI | InChI=1S/C33H45N3O/c1-22-27-11-12-29-26-10-9-24-19-25(13-16-32(24,2)28(26)14-17-33(27,29)21-34(22)3)35(4)31(37)20-36-18-15-23-7-5-6-8-30(23)36/h5-9,15,18,22,25-29H,10-14,16-17,19-21H2,1-4H3/t22-,25-,26+,27+,28?,29-,32-,33-/m0/s1 |
| InChIKey | NXJHLRSUDXWWRR-BZXRVZBMSA-N |
| XLogP | 6.36 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|