C11H9NO — CID 11579196
3-oxo-2,4-dihydro-1H-naphthalene-2-carbonitrile (PubChem CID 11579196) has the molecular formula C11H9NO and a molecular weight of 171.20 g/mol. Its IUPAC name is 3-oxo-2,4-dihydro-1H-naphthalene-2-carbonitrile.
| Compound Name | 3-oxo-2,4-dihydro-1H-naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 11579196 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 3-oxo-2,4-dihydro-1H-naphthalene-2-carbonitrile |
| SMILES | N#CC1Cc2ccccc2CC1=O |
| InChI | InChI=1S/C11H9NO/c12-7-10-5-8-3-1-2-4-9(8)6-11(10)13/h1-4,10H,5-6H2 |
| InChIKey | XLLYXDLOWMCXOW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|