C35H58O3Si — CID 117070478
1-methyl-2-[(E,3S)-3-methyl-4-phenylmethoxybut-1-enyl]-8-[3-methyl-1-tri(propan-2-yl)silyloxybutan-2-yl]bicyclo[2.2.2]oct-5-en-2-ol (PubChem CID 117070478) has the molecular formula C35H58O3Si and a molecular weight of 554.93 g/mol. Its IUPAC name is 1-methyl-2-[(E,3S)-3-methyl-4-phenylmethoxybut-1-enyl]-8-[3-methyl-1-tri(propan-2-yl)silyloxybutan-2-yl]bicyclo[2.2.2]oct-5-en-2-ol.
| Compound Name | 1-methyl-2-[(E,3S)-3-methyl-4-phenylmethoxybut-1-enyl]-8-[3-methyl-1-tri(propan-2-yl)silyloxybutan-2-yl]bicyclo[2.2.2]oct-5-en-2-ol |
|---|---|
| PubChem CID | 117070478 |
| Molecular Formula | C35H58O3Si |
| Molecular Weight | 554.93 g/mol |
| Exact Mass | 554.42 |
| IUPAC Name | 1-methyl-2-[(E,3S)-3-methyl-4-phenylmethoxybut-1-enyl]-8-[3-methyl-1-tri(propan-2-yl)silyloxybutan-2-yl]bicyclo[2.2.2]oct-5-en-2-ol |
| SMILES | CC(C)C(CO[Si](C(C)C)(C(C)C)C(C)C)C1CC2(C)C=CC1CC2(O)/C=C/[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C35H58O3Si/c1-25(2)33(24-38-39(26(3)4,27(5)6)28(7)8)32-21-34(10)18-17-31(32)20-35(34,36)19-16-29(9)22-37-23-30-14-12-11-13-15-30/h11-19,25-29,31-33,36H,20-24H2,1-10H3/b19-16+/t29-,31?,32?,33?,34?,35?/m0/s1 |
| InChIKey | SKVIFVQYJRCLER-BGULKOIQSA-N |
| XLogP | 9.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.93 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|