C29H48O5Si — CID 134944001
(5S,8R)-1,4-dimethyl-3-[(2R)-1-phenylmethoxypropan-2-yl]-8-[tri(propan-2-yl)silyloxymethyl]-2,9-dioxabicyclo[3.3.1]non-6-en-8-ol (PubChem CID 134944001) has the molecular formula C29H48O5Si and a molecular weight of 504.78 g/mol. Its IUPAC name is (5S,8R)-1,4-dimethyl-3-[(2R)-1-phenylmethoxypropan-2-yl]-8-[tri(propan-2-yl)silyloxymethyl]-2,9-dioxabicyclo[3.3.1]non-6-en-8-ol.
| Compound Name | (5S,8R)-1,4-dimethyl-3-[(2R)-1-phenylmethoxypropan-2-yl]-8-[tri(propan-2-yl)silyloxymethyl]-2,9-dioxabicyclo[3.3.1]non-6-en-8-ol |
|---|---|
| PubChem CID | 134944001 |
| Molecular Formula | C29H48O5Si |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 504.33 |
| IUPAC Name | (5S,8R)-1,4-dimethyl-3-[(2R)-1-phenylmethoxypropan-2-yl]-8-[tri(propan-2-yl)silyloxymethyl]-2,9-dioxabicyclo[3.3.1]non-6-en-8-ol |
| SMILES | CC1C([C@H](C)COCc2ccccc2)OC2(C)O[C@H]1C=C[C@@]2(O)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H48O5Si/c1-20(2)35(21(3)4,22(5)6)32-19-29(30)16-15-26-24(8)27(34-28(29,9)33-26)23(7)17-31-18-25-13-11-10-12-14-25/h10-16,20-24,26-27,30H,17-19H2,1-9H3/t23-,24?,26+,27?,28?,29-/m1/s1 |
| InChIKey | BRBFMWWLECSFDA-BGAUKXMISA-N |
| XLogP | 6.47 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|