C12H10N2O3 — CID 117332200
7-(1-isocyanatocyclopropyl)-4H-1,4-benzoxazin-3-one (PubChem CID 117332200) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 7-(1-isocyanatocyclopropyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-(1-isocyanatocyclopropyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 117332200 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 7-(1-isocyanatocyclopropyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C=NC1(c2ccc3c(c2)OCC(=O)N3)CC1 |
| InChI | InChI=1S/C12H10N2O3/c15-7-13-12(3-4-12)8-1-2-9-10(5-8)17-6-11(16)14-9/h1-2,5H,3-4,6H2,(H,14,16) |
| InChIKey | AJZJJZMHEUHUJV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|