C31H60O7Si — CID 11734511
ethyl (E,3R,6R)-3-[(2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1-[2-(2-methylpropyl)-1,3-dioxolan-2-yl]pentan-3-yl]-6-(methoxymethoxy)-2-methylhept-4-enoate (PubChem CID 11734511) has the molecular formula C31H60O7Si and a molecular weight of 572.90 g/mol. Its IUPAC name is ethyl (E,3R,6R)-3-[(2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1-[2-(2-methylpropyl)-1,3-dioxolan-2-yl]pentan-3-yl]-6-(methoxymethoxy)-2-methylhept-4-enoate.
| Compound Name | ethyl (E,3R,6R)-3-[(2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1-[2-(2-methylpropyl)-1,3-dioxolan-2-yl]pentan-3-yl]-6-(methoxymethoxy)-2-methylhept-4-enoate |
|---|---|
| PubChem CID | 11734511 |
| Molecular Formula | C31H60O7Si |
| Molecular Weight | 572.90 g/mol |
| Exact Mass | 572.41 |
| IUPAC Name | ethyl (E,3R,6R)-3-[(2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1-[2-(2-methylpropyl)-1,3-dioxolan-2-yl]pentan-3-yl]-6-(methoxymethoxy)-2-methylhept-4-enoate |
| SMILES | CCOC(=O)C(C)[C@H](/C=C/[C@@H](C)OCOC)[C@H](CCO[Si](C)(C)C(C)(C)C)[C@H](C)CC1(CC(C)C)OCCO1 |
| InChI | InChI=1S/C31H60O7Si/c1-13-34-29(32)26(6)28(15-14-25(5)35-22-33-10)27(16-17-38-39(11,12)30(7,8)9)24(4)21-31(20-23(2)3)36-18-19-37-31/h14-15,23-28H,13,16-22H2,1-12H3/b15-14+/t24-,25-,26?,27-,28+/m1/s1 |
| InChIKey | RFMLYFMDNPUEPB-GCIBYNSMSA-N |
| XLogP | 7.21 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.90 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|