C15H19N3O — CID 117396834
O-[2-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-7-yl)ethyl]hydroxylamine (PubChem CID 117396834) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is O-[2-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-7-yl)ethyl]hydroxylamine.
| Compound Name | O-[2-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-7-yl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117396834 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | O-[2-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-7-yl)ethyl]hydroxylamine |
| SMILES | NOCCc1cccc2c3c([nH]c12)N1CCC3CC1 |
| InChI | InChI=1S/C15H19N3O/c16-19-9-6-11-2-1-3-12-13-10-4-7-18(8-5-10)15(13)17-14(11)12/h1-3,10,17H,4-9,16H2 |
| InChIKey | PSFIXAIJXRFBQP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|