C24H36O6 — CID 11742890
[(1S,2R,5S,6R)-2,5-dihydroxy-6-[(2E,6E)-1-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-7-oxabicyclo[4.1.0]hept-3-en-3-yl]methyl acetate (PubChem CID 11742890) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is [(1S,2R,5S,6R)-2,5-dihydroxy-6-[(2E,6E)-1-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-7-oxabicyclo[4.1.0]hept-3-en-3-yl]methyl acetate.
| Compound Name | [(1S,2R,5S,6R)-2,5-dihydroxy-6-[(2E,6E)-1-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-7-oxabicyclo[4.1.0]hept-3-en-3-yl]methyl acetate |
|---|---|
| PubChem CID | 11742890 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [(1S,2R,5S,6R)-2,5-dihydroxy-6-[(2E,6E)-1-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-7-oxabicyclo[4.1.0]hept-3-en-3-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C[C@H](O)[C@@]2(C(O)/C=C(\C)CC/C=C(\C)CCC=C(C)C)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C24H36O6/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-20(26)24-21(27)13-19(14-29-18(5)25)22(28)23(24)30-24/h8,10,12-13,20-23,26-28H,6-7,9,11,14H2,1-5H3/b16-10+,17-12+/t20?,21-,22+,23-,24+/m0/s1 |
| InChIKey | FOIBYGGVEAKTKV-WUKJAGIRSA-N |
| XLogP | 3.13 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|