C18H28ClFN4O2Si — CID 11750345
(Z)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(6-chloropurin-9-yl)-4-fluoropent-3-en-1-ol (PubChem CID 11750345) has the molecular formula C18H28ClFN4O2Si and a molecular weight of 414.99 g/mol. Its IUPAC name is (Z)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(6-chloropurin-9-yl)-4-fluoropent-3-en-1-ol.
| Compound Name | (Z)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(6-chloropurin-9-yl)-4-fluoropent-3-en-1-ol |
|---|---|
| PubChem CID | 11750345 |
| Molecular Formula | C18H28ClFN4O2Si |
| Molecular Weight | 414.99 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (Z)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(6-chloropurin-9-yl)-4-fluoropent-3-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC/C(CCO)=C(\F)Cn1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C18H28ClFN4O2Si/c1-18(2,3)27(4,5)26-9-7-13(6-8-25)14(20)10-24-12-23-15-16(19)21-11-22-17(15)24/h11-12,25H,6-10H2,1-5H3/b14-13- |
| InChIKey | KAYFPVUJTWAMKS-YPKPFQOOSA-N |
| XLogP | 4.50 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.99 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|