C14H19N — CID 118037152
1-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-amine (PubChem CID 118037152) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-amine.
| Compound Name | 1-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-amine |
|---|---|
| PubChem CID | 118037152 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 1-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-amine |
| SMILES | CC1c2cccc(N)c2CC12CCCC2 |
| InChI | InChI=1S/C14H19N/c1-10-11-5-4-6-13(15)12(11)9-14(10)7-2-3-8-14/h4-6,10H,2-3,7-9,15H2,1H3 |
| InChIKey | CCWSPDMXWRJPPF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|