C26H41NO4S2 — CID 118047657
[[2-(1-methoxycyclohexyl)-2-(4-methoxyphenyl)ethyl]-methylamino]methyl 5-[(3R)-dithiolan-3-yl]pentanoate (PubChem CID 118047657) has the molecular formula C26H41NO4S2 and a molecular weight of 495.75 g/mol. Its IUPAC name is [[2-(1-methoxycyclohexyl)-2-(4-methoxyphenyl)ethyl]-methylamino]methyl 5-[(3R)-dithiolan-3-yl]pentanoate.
| Compound Name | [[2-(1-methoxycyclohexyl)-2-(4-methoxyphenyl)ethyl]-methylamino]methyl 5-[(3R)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 118047657 |
| Molecular Formula | C26H41NO4S2 |
| Molecular Weight | 495.75 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | [[2-(1-methoxycyclohexyl)-2-(4-methoxyphenyl)ethyl]-methylamino]methyl 5-[(3R)-dithiolan-3-yl]pentanoate |
| SMILES | COc1ccc(C(CN(C)COC(=O)CCCC[C@@H]2CCSS2)C2(OC)CCCCC2)cc1 |
| InChI | InChI=1S/C26H41NO4S2/c1-27(20-31-25(28)10-6-5-9-23-15-18-32-33-23)19-24(21-11-13-22(29-2)14-12-21)26(30-3)16-7-4-8-17-26/h11-14,23-24H,4-10,15-20H2,1-3H3/t23-,24?/m1/s1 |
| InChIKey | ZIIDJIILBWPQHT-MIHMCVIASA-N |
| XLogP | 6.27 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.75 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|