C28H32O3S2 — CID 11812847
(E)-4-(4-methylphenyl)sulfonyl-1-[(1R,2S)-2-[(2Z,4E)-5-phenylsulfanylpenta-2,4-dien-2-yl]cyclohexyl]but-3-en-2-one (PubChem CID 11812847) has the molecular formula C28H32O3S2 and a molecular weight of 480.70 g/mol. Its IUPAC name is (E)-4-(4-methylphenyl)sulfonyl-1-[(1R,2S)-2-[(2Z,4E)-5-phenylsulfanylpenta-2,4-dien-2-yl]cyclohexyl]but-3-en-2-one.
| Compound Name | (E)-4-(4-methylphenyl)sulfonyl-1-[(1R,2S)-2-[(2Z,4E)-5-phenylsulfanylpenta-2,4-dien-2-yl]cyclohexyl]but-3-en-2-one |
|---|---|
| PubChem CID | 11812847 |
| Molecular Formula | C28H32O3S2 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | (E)-4-(4-methylphenyl)sulfonyl-1-[(1R,2S)-2-[(2Z,4E)-5-phenylsulfanylpenta-2,4-dien-2-yl]cyclohexyl]but-3-en-2-one |
| SMILES | C/C(=C/C=C/Sc1ccccc1)[C@H]1CCCC[C@@H]1CC(=O)/C=C/S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H32O3S2/c1-22-14-16-27(17-15-22)33(30,31)20-18-25(29)21-24-10-6-7-13-28(24)23(2)9-8-19-32-26-11-4-3-5-12-26/h3-5,8-9,11-12,14-20,24,28H,6-7,10,13,21H2,1-2H3/b19-8+,20-18+,23-9-/t24-,28-/m1/s1 |
| InChIKey | HZDMETVEGLFKFJ-HDQNLHAESA-N |
| XLogP | 7.30 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|