C34H42O2SSi — CID 11813560
1-[(1R,3aR,7aS)-7a-[tert-butyl(diphenyl)silyl]oxy-3a-methyl-3-phenylsulfanyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]ethanone (PubChem CID 11813560) has the molecular formula C34H42O2SSi and a molecular weight of 542.86 g/mol. Its IUPAC name is 1-[(1R,3aR,7aS)-7a-[tert-butyl(diphenyl)silyl]oxy-3a-methyl-3-phenylsulfanyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]ethanone.
| Compound Name | 1-[(1R,3aR,7aS)-7a-[tert-butyl(diphenyl)silyl]oxy-3a-methyl-3-phenylsulfanyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]ethanone |
|---|---|
| PubChem CID | 11813560 |
| Molecular Formula | C34H42O2SSi |
| Molecular Weight | 542.86 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 1-[(1R,3aR,7aS)-7a-[tert-butyl(diphenyl)silyl]oxy-3a-methyl-3-phenylsulfanyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CC(Sc2ccccc2)[C@]2(C)CCCC[C@]12O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H42O2SSi/c1-26(35)30-25-31(37-27-17-9-6-10-18-27)33(5)23-15-16-24-34(30,33)36-38(32(2,3)4,28-19-11-7-12-20-28)29-21-13-8-14-22-29/h6-14,17-22,30-31H,15-16,23-25H2,1-5H3/t30-,31?,33-,34-/m0/s1 |
| InChIKey | NOJSXLFATVFFTL-YAEAUZKDSA-N |
| XLogP | 7.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.86 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|