C15H20O7S — CID 11824121
[(3R,4R,5S)-4-(methoxymethyl)-2-oxo-5-(phenylmethoxymethyl)oxolan-3-yl] methanesulfonate (PubChem CID 11824121) has the molecular formula C15H20O7S and a molecular weight of 344.38 g/mol. Its IUPAC name is [(3R,4R,5S)-4-(methoxymethyl)-2-oxo-5-(phenylmethoxymethyl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(3R,4R,5S)-4-(methoxymethyl)-2-oxo-5-(phenylmethoxymethyl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 11824121 |
| Molecular Formula | C15H20O7S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [(3R,4R,5S)-4-(methoxymethyl)-2-oxo-5-(phenylmethoxymethyl)oxolan-3-yl] methanesulfonate |
| SMILES | COC[C@@H]1[C@@H](COCc2ccccc2)OC(=O)[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C15H20O7S/c1-19-9-12-13(10-20-8-11-6-4-3-5-7-11)21-15(16)14(12)22-23(2,17)18/h3-7,12-14H,8-10H2,1-2H3/t12-,13-,14-/m1/s1 |
| InChIKey | CQRLHINPQOLVEQ-MGPQQGTHSA-N |
| XLogP | 0.74 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|