C26H46N5O3S2+ — CID 118260619
trimethyl-[2-[[2-methyl-4-(propan-2-ylcarbamoyl)-6-[2-(pyridin-2-yldisulfanyl)ethylcarbamoyl]octanoyl]amino]ethyl]azanium (PubChem CID 118260619) has the molecular formula C26H46N5O3S2+ and a molecular weight of 540.82 g/mol. Its IUPAC name is trimethyl-[2-[[2-methyl-4-(propan-2-ylcarbamoyl)-6-[2-(pyridin-2-yldisulfanyl)ethylcarbamoyl]octanoyl]amino]ethyl]azanium.
| Compound Name | trimethyl-[2-[[2-methyl-4-(propan-2-ylcarbamoyl)-6-[2-(pyridin-2-yldisulfanyl)ethylcarbamoyl]octanoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 118260619 |
| Molecular Formula | C26H46N5O3S2+ |
| Molecular Weight | 540.82 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | trimethyl-[2-[[2-methyl-4-(propan-2-ylcarbamoyl)-6-[2-(pyridin-2-yldisulfanyl)ethylcarbamoyl]octanoyl]amino]ethyl]azanium |
| SMILES | CCC(CC(CC(C)C(=O)NCC[N+](C)(C)C)C(=O)NC(C)C)C(=O)NCCSSc1ccccn1 |
| InChI | InChI=1S/C26H45N5O3S2/c1-8-21(25(33)29-14-16-35-36-23-11-9-10-12-27-23)18-22(26(34)30-19(2)3)17-20(4)24(32)28-13-15-31(5,6)7/h9-12,19-22H,8,13-18H2,1-7H3,(H2-,28,29,30,32,33,34)/p+1 |
| InChIKey | ANYZEQONYMWCMP-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.82 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|