C25H24F3N5O3 — CID 118423178
tert-butyl N-[(7R,8S)-3-(5-methyl-1,2,4-oxadiazol-3-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamate (PubChem CID 118423178) has the molecular formula C25H24F3N5O3 and a molecular weight of 499.49 g/mol. Its IUPAC name is tert-butyl N-[(7R,8S)-3-(5-methyl-1,2,4-oxadiazol-3-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamate.
| Compound Name | tert-butyl N-[(7R,8S)-3-(5-methyl-1,2,4-oxadiazol-3-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamate |
|---|---|
| PubChem CID | 118423178 |
| Molecular Formula | C25H24F3N5O3 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | tert-butyl N-[(7R,8S)-3-(5-methyl-1,2,4-oxadiazol-3-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamate |
| SMILES | Cc1nc(-c2ccn3c4c(nc3c2)C[C@H](c2cc(F)c(F)cc2F)[C@@H](NC(=O)OC(C)(C)C)C4)no1 |
| InChI | InChI=1S/C25H24F3N5O3/c1-12-29-23(32-36-12)13-5-6-33-21-11-19(31-24(34)35-25(2,3)4)15(9-20(21)30-22(33)7-13)14-8-17(27)18(28)10-16(14)26/h5-8,10,15,19H,9,11H2,1-4H3,(H,31,34)/t15-,19+/m1/s1 |
| InChIKey | NSJBYXRQNHXZAR-BEFAXECRSA-N |
| XLogP | 4.89 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|