C24H22F3N5O3 — CID 123319919
tert-butyl N-[3-(1,2,4-oxadiazol-5-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamate (PubChem CID 123319919) has the molecular formula C24H22F3N5O3 and a molecular weight of 485.47 g/mol. Its IUPAC name is tert-butyl N-[3-(1,2,4-oxadiazol-5-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamate.
| Compound Name | tert-butyl N-[3-(1,2,4-oxadiazol-5-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamate |
|---|---|
| PubChem CID | 123319919 |
| Molecular Formula | C24H22F3N5O3 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | tert-butyl N-[3-(1,2,4-oxadiazol-5-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1Cc2c(nc3cc(-c4ncno4)ccn23)CC1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C24H22F3N5O3/c1-24(2,3)34-23(33)31-18-10-20-19(8-14(18)13-7-16(26)17(27)9-15(13)25)30-21-6-12(4-5-32(20)21)22-28-11-29-35-22/h4-7,9,11,14,18H,8,10H2,1-3H3,(H,31,33) |
| InChIKey | IHFHYEJFQDLFRP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|