C26H28F3N5O3 — CID 90176232
tert-butyl N-[(7R,8S)-3-(dimethylaminomethylidenecarbamoyl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamate (PubChem CID 90176232) has the molecular formula C26H28F3N5O3 and a molecular weight of 515.54 g/mol. Its IUPAC name is tert-butyl N-[(7R,8S)-3-(dimethylaminomethylidenecarbamoyl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamate.
| Compound Name | tert-butyl N-[(7R,8S)-3-(dimethylaminomethylidenecarbamoyl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamate |
|---|---|
| PubChem CID | 90176232 |
| Molecular Formula | C26H28F3N5O3 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | tert-butyl N-[(7R,8S)-3-(dimethylaminomethylidenecarbamoyl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamate |
| SMILES | CN(C)/C=N/C(=O)c1ccn2c3c(nc2c1)C[C@H](c1cc(F)c(F)cc1F)[C@@H](NC(=O)OC(C)(C)C)C3 |
| InChI | InChI=1S/C26H28F3N5O3/c1-26(2,3)37-25(36)32-20-12-22-21(10-16(20)15-9-18(28)19(29)11-17(15)27)31-23-8-14(6-7-34(22)23)24(35)30-13-33(4)5/h6-9,11,13,16,20H,10,12H2,1-5H3,(H,32,36)/b30-13+/t16-,20+/m1/s1 |
| InChIKey | NOYVZUOLFTYMHC-VUWZVZDHSA-N |
| XLogP | 4.26 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|