C29H40ClN3O6 — CID 118497229
(E)-6-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyanilino]-5-(3-methoxypropoxy)-4-methylhex-2-enoic acid (PubChem CID 118497229) has the molecular formula C29H40ClN3O6 and a molecular weight of 562.11 g/mol. Its IUPAC name is (E)-6-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyanilino]-5-(3-methoxypropoxy)-4-methylhex-2-enoic acid.
| Compound Name | (E)-6-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyanilino]-5-(3-methoxypropoxy)-4-methylhex-2-enoic acid |
|---|---|
| PubChem CID | 118497229 |
| Molecular Formula | C29H40ClN3O6 |
| Molecular Weight | 562.11 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | (E)-6-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyanilino]-5-(3-methoxypropoxy)-4-methylhex-2-enoic acid |
| SMILES | COCCCOC(CNc1ccc(O[C@@H]2CCN(c3cc(OC)ncc3Cl)C[C@H]2C)cc1)C(C)/C=C/C(=O)O |
| InChI | InChI=1S/C29H40ClN3O6/c1-20(6-11-29(34)35)27(38-15-5-14-36-3)18-31-22-7-9-23(10-8-22)39-26-12-13-33(19-21(26)2)25-16-28(37-4)32-17-24(25)30/h6-11,16-17,20-21,26-27,31H,5,12-15,18-19H2,1-4H3,(H,34,35)/b11-6+/t20?,21-,26-,27?/m1/s1 |
| InChIKey | ZBFOYMLKKSOBBH-PCSHWUQDSA-N |
| XLogP | 5.15 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.11 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|