C29H32N6O5 — CID 118508447
[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]-(6-propan-2-yloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)diazene (PubChem CID 118508447) has the molecular formula C29H32N6O5 and a molecular weight of 544.61 g/mol. Its IUPAC name is [2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]-(6-propan-2-yloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)diazene.
| Compound Name | [2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]-(6-propan-2-yloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)diazene |
|---|---|
| PubChem CID | 118508447 |
| Molecular Formula | C29H32N6O5 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | [2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]-(6-propan-2-yloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)diazene |
| SMILES | COc1cc(/N=N/c2cc3c4c(c2OC(C)C)CCCN4CCC3)c(OC)cc1/N=N/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H32N6O5/c1-18(2)40-29-22-8-6-14-34-13-5-7-19(28(22)34)15-25(29)33-32-24-17-26(38-3)23(16-27(24)39-4)31-30-20-9-11-21(12-10-20)35(36)37/h9-12,15-18H,5-8,13-14H2,1-4H3/b31-30+,33-32+ |
| InChIKey | DKLIRIZOGPCQHZ-CJQWSLHQSA-N |
| XLogP | 7.93 |
| TPSA | 123.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|