C33H40IN6O5- — CID 163534276
[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]-(4,4,10,10-tetramethyl-6-propan-2-yliodanuidyloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)diazene (PubChem CID 163534276) has the molecular formula C33H40IN6O5- and a molecular weight of 727.62 g/mol. Its IUPAC name is [2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]-(4,4,10,10-tetramethyl-6-propan-2-yliodanuidyloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)diazene.
| Compound Name | [2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]-(4,4,10,10-tetramethyl-6-propan-2-yliodanuidyloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)diazene |
|---|---|
| PubChem CID | 163534276 |
| Molecular Formula | C33H40IN6O5- |
| Molecular Weight | 727.62 g/mol |
| Exact Mass | 727.21 |
| IUPAC Name | [2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]-(4,4,10,10-tetramethyl-6-propan-2-yliodanuidyloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)diazene |
| SMILES | COc1cc(/N=N/c2cc3c4c(c2O[I-]C(C)C)C(C)(C)CCN4CCC3(C)C)c(OC)cc1/N=N/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H40IN6O5/c1-20(2)34-45-31-26(17-23-30-29(31)33(5,6)14-16-39(30)15-13-32(23,3)4)38-37-25-19-27(43-7)24(18-28(25)44-8)36-35-21-9-11-22(12-10-21)40(41)42/h9-12,17-20H,13-16H2,1-8H3/q-1/b36-35+,38-37+ |
| InChIKey | SYZLSURXWUKKSX-JKWOPUAESA-N |
| XLogP | 6.40 |
| TPSA | 123.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|