C17H26O4 — CID 118535993
methanol;2-(oxiran-2-ylmethoxymethyl)oxirane;tricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 118535993) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is methanol;2-(oxiran-2-ylmethoxymethyl)oxirane;tricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | methanol;2-(oxiran-2-ylmethoxymethyl)oxirane;tricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 118535993 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | methanol;2-(oxiran-2-ylmethoxymethyl)oxirane;tricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C(OCC1CO1)C1CO1.C1=CC2C3C=CC(C3)C2C1.CO |
| InChI | InChI=1S/C10H12.C6H10O3.CH4O/c1-2-9-7-4-5-8(6-7)10(9)3-1;1(5-3-8-5)7-2-6-4-9-6;1-2/h1-2,4-5,7-10H,3,6H2;5-6H,1-4H2;2H,1H3 |
| InChIKey | VVZKAFJHAFGJQX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|