C13H17NS — CID 174828034
4,5-dihydro-1,3-thiazole;tricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 174828034) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is 4,5-dihydro-1,3-thiazole;tricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | 4,5-dihydro-1,3-thiazole;tricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 174828034 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 4,5-dihydro-1,3-thiazole;tricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C1=CC2C3C=CC(C3)C2C1.C1=NCCS1 |
| InChI | InChI=1S/C10H12.C3H5NS/c1-2-9-7-4-5-8(6-7)10(9)3-1;1-2-5-3-4-1/h1-2,4-5,7-10H,3,6H2;3H,1-2H2 |
| InChIKey | ULWYKWMOKKAXQI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|