C16H22O3 — CID 23124038
2-(oxiran-2-ylmethoxymethyl)oxirane;tricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 23124038) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;tricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;tricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 23124038 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;tricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C(OCC1CO1)C1CO1.C1=CC2C3C=CC(C3)C2C1 |
| InChI | InChI=1S/C10H12.C6H10O3/c1-2-9-7-4-5-8(6-7)10(9)3-1;1(5-3-8-5)7-2-6-4-9-6/h1-2,4-5,7-10H,3,6H2;5-6H,1-4H2 |
| InChIKey | JQZFQDDRIKMYFI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|