C13H14N2O — CID 118549048
3-methyl-5-[4-(nitrosomethyl)phenyl]-1,2-dihydropyridine (PubChem CID 118549048) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-methyl-5-[4-(nitrosomethyl)phenyl]-1,2-dihydropyridine.
| Compound Name | 3-methyl-5-[4-(nitrosomethyl)phenyl]-1,2-dihydropyridine |
|---|---|
| PubChem CID | 118549048 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 3-methyl-5-[4-(nitrosomethyl)phenyl]-1,2-dihydropyridine |
| SMILES | CC1=CC(c2ccc(CN=O)cc2)=CNC1 |
| InChI | InChI=1S/C13H14N2O/c1-10-6-13(9-14-7-10)12-4-2-11(3-5-12)8-15-16/h2-6,9,14H,7-8H2,1H3 |
| InChIKey | UFHCRQIBFGJFCS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |