C31H32F4O5 — CID 118596063
[(3R,4R,5R)-4-butoxy-3-fluoro-5-(trifluoromethyl)-5-(trityloxymethyl)oxolan-2-yl] acetate (PubChem CID 118596063) has the molecular formula C31H32F4O5 and a molecular weight of 560.58 g/mol. Its IUPAC name is [(3R,4R,5R)-4-butoxy-3-fluoro-5-(trifluoromethyl)-5-(trityloxymethyl)oxolan-2-yl] acetate.
| Compound Name | [(3R,4R,5R)-4-butoxy-3-fluoro-5-(trifluoromethyl)-5-(trityloxymethyl)oxolan-2-yl] acetate |
|---|---|
| PubChem CID | 118596063 |
| Molecular Formula | C31H32F4O5 |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | [(3R,4R,5R)-4-butoxy-3-fluoro-5-(trifluoromethyl)-5-(trityloxymethyl)oxolan-2-yl] acetate |
| SMILES | CCCCO[C@H]1[C@@H](F)C(OC(C)=O)O[C@@]1(COC(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C31H32F4O5/c1-3-4-20-37-27-26(32)28(39-22(2)36)40-29(27,31(33,34)35)21-38-30(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,26-28H,3-4,20-21H2,1-2H3/t26-,27+,28?,29-/m1/s1 |
| InChIKey | FGYRHIKBUQYDID-WAAVWZAJSA-N |
| XLogP | 6.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|