C5H11BrO3 — CID 118614047
2-bromo-3,3-dimethoxypropan-1-ol (PubChem CID 118614047) has the molecular formula C5H11BrO3 and a molecular weight of 199.04 g/mol. Its IUPAC name is 2-bromo-3,3-dimethoxypropan-1-ol.
| Compound Name | 2-bromo-3,3-dimethoxypropan-1-ol |
|---|---|
| PubChem CID | 118614047 |
| Molecular Formula | C5H11BrO3 |
| Molecular Weight | 199.04 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | 2-bromo-3,3-dimethoxypropan-1-ol |
| SMILES | COC(OC)C(Br)CO |
| InChI | InChI=1S/C5H11BrO3/c1-8-5(9-2)4(6)3-7/h4-5,7H,3H2,1-2H3 |
| InChIKey | AGTBZXPFCFUTOI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.04 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|